About acetic acid;1-ethyl-2-phenylbenzene
acetic acid;1-ethyl-2-phenylbenzene (PubChem CID 67681814) has the molecular formula C16H18O2
and a molecular weight of 242.32 g/mol. Its IUPAC name is acetic acid;1-ethyl-2-phenylbenzene.
Molecular Properties
| Compound Name | acetic acid;1-ethyl-2-phenylbenzene |
| PubChem CID | 67681814 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | acetic acid;1-ethyl-2-phenylbenzene |
| SMILES | CC(=O)O.CCc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C14H14.C2H4O2/c1-2-12-8-6-7-11-14(12)13-9-4-3-5-10-13;1-2(3)4/h3-11H,2H2,1H3;1H3,(H,3,4) |
| InChIKey | IAOOGJGMOZBZRQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetic acid;1-ethyl-2-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;1-ethyl-2-phenylbenzene?
The IUPAC name of acetic acid;1-ethyl-2-phenylbenzene (CID 67681814) is acetic acid;1-ethyl-2-phenylbenzene.
What is the SMILES notation for acetic acid;1-ethyl-2-phenylbenzene?
The canonical SMILES for acetic acid;1-ethyl-2-phenylbenzene is CC(=O)O.CCc1ccccc1-c1ccccc1.
What is the InChIKey of acetic acid;1-ethyl-2-phenylbenzene?
The InChIKey is IAOOGJGMOZBZRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.C2H4O2/c1-2-12-8-6-7-11-14(12)13-9-4-3-5-10-13;1-2(3)4/h3-11H,2H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;1-ethyl-2-phenylbenzene?
acetic acid;1-ethyl-2-phenylbenzene has a molecular weight of 242.32 g/mol, XLogP of 4.01, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1-ethyl-2-phenylbenzene is sourced from PubChem (CID 67681814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).