C9H16N2O2S — CID 67800161
1-ethyl-2-methylbenzene;sulfamide (PubChem CID 67800161) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 1-ethyl-2-methylbenzene;sulfamide.
| Compound Name | 1-ethyl-2-methylbenzene;sulfamide |
|---|---|
| PubChem CID | 67800161 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 1-ethyl-2-methylbenzene;sulfamide |
| SMILES | CCc1ccccc1C.NS(N)(=O)=O |
| InChI | InChI=1S/C9H12.H4N2O2S/c1-3-9-7-5-4-6-8(9)2;1-5(2,3)4/h4-7H,3H2,1-2H3;(H4,1,2,3,4) |
| InChIKey | LCOAUVKBPUBKJX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |