C14H18O4 — CID 174498870
1,2-diethylbenzene;2-methylidenepropanedioic acid (PubChem CID 174498870) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 1,2-diethylbenzene;2-methylidenepropanedioic acid.
| Compound Name | 1,2-diethylbenzene;2-methylidenepropanedioic acid |
|---|---|
| PubChem CID | 174498870 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 1,2-diethylbenzene;2-methylidenepropanedioic acid |
| SMILES | C=C(C(=O)O)C(=O)O.CCc1ccccc1CC |
| InChI | InChI=1S/C10H14.C4H4O4/c1-3-9-7-5-6-8-10(9)4-2;1-2(3(5)6)4(7)8/h5-8H,3-4H2,1-2H3;1H2,(H,5,6)(H,7,8) |
| InChIKey | HWPJWUDRFYRBDA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|