C13H18 — CID 174831347
1,2-diethylbenzene;propa-1,2-diene (PubChem CID 174831347) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is 1,2-diethylbenzene;propa-1,2-diene.
| Compound Name | 1,2-diethylbenzene;propa-1,2-diene |
|---|---|
| PubChem CID | 174831347 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 1,2-diethylbenzene;propa-1,2-diene |
| SMILES | C=C=C.CCc1ccccc1CC |
| InChI | InChI=1S/C10H14.C3H4/c1-3-9-7-5-6-8-10(9)4-2;1-3-2/h5-8H,3-4H2,1-2H3;1-2H2 |
| InChIKey | DXDPABZYYBJCSS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |