C18H30 — CID 142228373
1,2-diethylbenzene;1,4-dimethylcyclohexane (PubChem CID 142228373) has the molecular formula C18H30 and a molecular weight of 246.44 g/mol. Its IUPAC name is 1,2-diethylbenzene;1,4-dimethylcyclohexane.
| Compound Name | 1,2-diethylbenzene;1,4-dimethylcyclohexane |
|---|---|
| PubChem CID | 142228373 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | 1,2-diethylbenzene;1,4-dimethylcyclohexane |
| SMILES | CC1CCC(C)CC1.CCc1ccccc1CC |
| InChI | InChI=1S/C10H14.C8H16/c1-3-9-7-5-6-8-10(9)4-2;1-7-3-5-8(2)6-4-7/h5-8H,3-4H2,1-2H3;7-8H,3-6H2,1-2H3 |
| InChIKey | LCCTYLLCYAWXSX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |