C13H20O — CID 174478177
1,2-diethylbenzene;propanal (PubChem CID 174478177) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 1,2-diethylbenzene;propanal.
| Compound Name | 1,2-diethylbenzene;propanal |
|---|---|
| PubChem CID | 174478177 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 1,2-diethylbenzene;propanal |
| SMILES | CCC=O.CCc1ccccc1CC |
| InChI | InChI=1S/C10H14.C3H6O/c1-3-9-7-5-6-8-10(9)4-2;1-2-3-4/h5-8H,3-4H2,1-2H3;3H,2H2,1H3 |
| InChIKey | HCPHLUOYNBHKED-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|