About 3-(2-butylphenyl)propanal;propanal
3-(2-butylphenyl)propanal;propanal (PubChem CID 175603438) has the molecular formula C16H24O2
and a molecular weight of 248.37 g/mol. Its IUPAC name is 3-(2-butylphenyl)propanal;propanal.
Molecular Properties
| Compound Name | 3-(2-butylphenyl)propanal;propanal |
| PubChem CID | 175603438 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 3-(2-butylphenyl)propanal;propanal |
| SMILES | CCC=O.CCCCc1ccccc1CCC=O |
| InChI | InChI=1S/C13H18O.C3H6O/c1-2-3-7-12-8-4-5-9-13(12)10-6-11-14;1-2-3-4/h4-5,8-9,11H,2-3,6-7,10H2,1H3;3H,2H2,1H3 |
| InChIKey | SBJUPMPNMQMADM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-butylphenyl)propanal;propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-butylphenyl)propanal;propanal?
The IUPAC name of 3-(2-butylphenyl)propanal;propanal (CID 175603438) is 3-(2-butylphenyl)propanal;propanal.
What is the SMILES notation for 3-(2-butylphenyl)propanal;propanal?
The canonical SMILES for 3-(2-butylphenyl)propanal;propanal is CCC=O.CCCCc1ccccc1CCC=O.
What is the InChIKey of 3-(2-butylphenyl)propanal;propanal?
The InChIKey is SBJUPMPNMQMADM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O.C3H6O/c1-2-3-7-12-8-4-5-9-13(12)10-6-11-14;1-2-3-4/h4-5,8-9,11H,2-3,6-7,10H2,1H3;3H,2H2,1H3.
What are the key properties of 3-(2-butylphenyl)propanal;propanal?
3-(2-butylphenyl)propanal;propanal has a molecular weight of 248.37 g/mol, XLogP of 3.76, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-butylphenyl)propanal;propanal is sourced from PubChem (CID 175603438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).