About 1-butyl-2-methylbenzene;pentanal
1-butyl-2-methylbenzene;pentanal (PubChem CID 175490673) has the molecular formula C16H26O
and a molecular weight of 234.38 g/mol. Its IUPAC name is 1-butyl-2-methylbenzene;pentanal.
Molecular Properties
| Compound Name | 1-butyl-2-methylbenzene;pentanal |
| PubChem CID | 175490673 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 1-butyl-2-methylbenzene;pentanal |
| SMILES | CCCCC=O.CCCCc1ccccc1C |
| InChI | InChI=1S/C11H16.C5H10O/c1-3-4-8-11-9-6-5-7-10(11)2;1-2-3-4-5-6/h5-7,9H,3-4,8H2,1-2H3;5H,2-4H2,1H3 |
| InChIKey | DWZYLIMOEXZPSZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-2-methylbenzene;pentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-methylbenzene;pentanal?
The IUPAC name of 1-butyl-2-methylbenzene;pentanal (CID 175490673) is 1-butyl-2-methylbenzene;pentanal.
What is the SMILES notation for 1-butyl-2-methylbenzene;pentanal?
The canonical SMILES for 1-butyl-2-methylbenzene;pentanal is CCCCC=O.CCCCc1ccccc1C.
What is the InChIKey of 1-butyl-2-methylbenzene;pentanal?
The InChIKey is DWZYLIMOEXZPSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16.C5H10O/c1-3-4-8-11-9-6-5-7-10(11)2;1-2-3-4-5-6/h5-7,9H,3-4,8H2,1-2H3;5H,2-4H2,1H3.
What are the key properties of 1-butyl-2-methylbenzene;pentanal?
1-butyl-2-methylbenzene;pentanal has a molecular weight of 234.38 g/mol, XLogP of 4.71, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-methylbenzene;pentanal is sourced from PubChem (CID 175490673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).