About 2-butylbenzaldehyde;1-butyl-2-methylbenzene
2-butylbenzaldehyde;1-butyl-2-methylbenzene (PubChem CID 88505905) has the molecular formula C22H30O
and a molecular weight of 310.48 g/mol. Its IUPAC name is 2-butylbenzaldehyde;1-butyl-2-methylbenzene.
Molecular Properties
| Compound Name | 2-butylbenzaldehyde;1-butyl-2-methylbenzene |
| PubChem CID | 88505905 |
| Molecular Formula | C22H30O |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 2-butylbenzaldehyde;1-butyl-2-methylbenzene |
| SMILES | CCCCc1ccccc1C.CCCCc1ccccc1C=O |
| InChI | InChI=1S/C11H14O.C11H16/c1-2-3-6-10-7-4-5-8-11(10)9-12;1-3-4-8-11-9-6-5-7-10(11)2/h4-5,7-9H,2-3,6H2,1H3;5-7,9H,3-4,8H2,1-2H3 |
| InChIKey | NTQXNSYRQLIXIJ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-butylbenzaldehyde;1-butyl-2-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylbenzaldehyde;1-butyl-2-methylbenzene?
The IUPAC name of 2-butylbenzaldehyde;1-butyl-2-methylbenzene (CID 88505905) is 2-butylbenzaldehyde;1-butyl-2-methylbenzene.
What is the SMILES notation for 2-butylbenzaldehyde;1-butyl-2-methylbenzene?
The canonical SMILES for 2-butylbenzaldehyde;1-butyl-2-methylbenzene is CCCCc1ccccc1C.CCCCc1ccccc1C=O.
What is the InChIKey of 2-butylbenzaldehyde;1-butyl-2-methylbenzene?
The InChIKey is NTQXNSYRQLIXIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O.C11H16/c1-2-3-6-10-7-4-5-8-11(10)9-12;1-3-4-8-11-9-6-5-7-10(11)2/h4-5,7-9H,2-3,6H2,1H3;5-7,9H,3-4,8H2,1-2H3.
What are the key properties of 2-butylbenzaldehyde;1-butyl-2-methylbenzene?
2-butylbenzaldehyde;1-butyl-2-methylbenzene has a molecular weight of 310.48 g/mol, XLogP of 6.18, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylbenzaldehyde;1-butyl-2-methylbenzene is sourced from PubChem (CID 88505905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).