About 2-butylbenzaldehyde;terephthalaldehyde
2-butylbenzaldehyde;terephthalaldehyde (PubChem CID 174801051) has the molecular formula C19H20O3
and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-butylbenzaldehyde;terephthalaldehyde.
Molecular Properties
| Compound Name | 2-butylbenzaldehyde;terephthalaldehyde |
| PubChem CID | 174801051 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-butylbenzaldehyde;terephthalaldehyde |
| SMILES | CCCCc1ccccc1C=O.O=Cc1ccc(C=O)cc1 |
| InChI | InChI=1S/C11H14O.C8H6O2/c1-2-3-6-10-7-4-5-8-11(10)9-12;9-5-7-1-2-8(6-10)4-3-7/h4-5,7-9H,2-3,6H2,1H3;1-6H |
| InChIKey | VVAVBSREASZRCB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-butylbenzaldehyde;terephthalaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylbenzaldehyde;terephthalaldehyde?
The IUPAC name of 2-butylbenzaldehyde;terephthalaldehyde (CID 174801051) is 2-butylbenzaldehyde;terephthalaldehyde.
What is the SMILES notation for 2-butylbenzaldehyde;terephthalaldehyde?
The canonical SMILES for 2-butylbenzaldehyde;terephthalaldehyde is CCCCc1ccccc1C=O.O=Cc1ccc(C=O)cc1.
What is the InChIKey of 2-butylbenzaldehyde;terephthalaldehyde?
The InChIKey is VVAVBSREASZRCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O.C8H6O2/c1-2-3-6-10-7-4-5-8-11(10)9-12;9-5-7-1-2-8(6-10)4-3-7/h4-5,7-9H,2-3,6H2,1H3;1-6H.
What are the key properties of 2-butylbenzaldehyde;terephthalaldehyde?
2-butylbenzaldehyde;terephthalaldehyde has a molecular weight of 296.37 g/mol, XLogP of 4.15, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylbenzaldehyde;terephthalaldehyde is sourced from PubChem (CID 174801051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).