C14H20O2 — CID 174903313
acetic acid;1-butyl-2-ethenylbenzene (PubChem CID 174903313) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is acetic acid;1-butyl-2-ethenylbenzene.
| Compound Name | acetic acid;1-butyl-2-ethenylbenzene |
|---|---|
| PubChem CID | 174903313 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | acetic acid;1-butyl-2-ethenylbenzene |
| SMILES | C=Cc1ccccc1CCCC.CC(=O)O |
| InChI | InChI=1S/C12H16.C2H4O2/c1-3-5-8-12-10-7-6-9-11(12)4-2;1-2(3)4/h4,6-7,9-10H,2-3,5,8H2,1H3;1H3,(H,3,4) |
| InChIKey | CVQOSGVEBJRXHZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |