C24H22O2 — CID 174766934
1,2-diphenylethane-1,2-dione;1-ethenyl-2-ethylbenzene (PubChem CID 174766934) has the molecular formula C24H22O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1,2-diphenylethane-1,2-dione;1-ethenyl-2-ethylbenzene.
| Compound Name | 1,2-diphenylethane-1,2-dione;1-ethenyl-2-ethylbenzene |
|---|---|
| PubChem CID | 174766934 |
| Molecular Formula | C24H22O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1,2-diphenylethane-1,2-dione;1-ethenyl-2-ethylbenzene |
| SMILES | C=Cc1ccccc1CC.O=C(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H10O2.C10H12/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;1-3-9-7-5-6-8-10(9)4-2/h1-10H;3,5-8H,1,4H2,2H3 |
| InChIKey | CXGUSUGQEFOTOC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|