C22H28ClNO2 — CID 173216030
azane;1-(2-ethenyl-3,4,5-triethylphenyl)-2-phenylethane-1,2-dione;hydrochloride (PubChem CID 173216030) has the molecular formula C22H28ClNO2 and a molecular weight of 373.92 g/mol. Its IUPAC name is azane;1-(2-ethenyl-3,4,5-triethylphenyl)-2-phenylethane-1,2-dione;hydrochloride.
| Compound Name | azane;1-(2-ethenyl-3,4,5-triethylphenyl)-2-phenylethane-1,2-dione;hydrochloride |
|---|---|
| PubChem CID | 173216030 |
| Molecular Formula | C22H28ClNO2 |
| Molecular Weight | 373.92 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | azane;1-(2-ethenyl-3,4,5-triethylphenyl)-2-phenylethane-1,2-dione;hydrochloride |
| SMILES | C=Cc1c(C(=O)C(=O)c2ccccc2)cc(CC)c(CC)c1CC.Cl.N |
| InChI | InChI=1S/C22H24O2.ClH.H3N/c1-5-15-14-20(19(8-4)18(7-3)17(15)6-2)22(24)21(23)16-12-10-9-11-13-16;;/h8-14H,4-7H2,1-3H3;1H;1H3 |
| InChIKey | VFBMALRDLKSEID-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.92 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|