C17H18ClNO2 — CID 70188941
azane;3-chloroprop-1-ene;1,2-diphenylethane-1,2-dione (PubChem CID 70188941) has the molecular formula C17H18ClNO2 and a molecular weight of 303.79 g/mol. Its IUPAC name is azane;3-chloroprop-1-ene;1,2-diphenylethane-1,2-dione.
| Compound Name | azane;3-chloroprop-1-ene;1,2-diphenylethane-1,2-dione |
|---|---|
| PubChem CID | 70188941 |
| Molecular Formula | C17H18ClNO2 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | azane;3-chloroprop-1-ene;1,2-diphenylethane-1,2-dione |
| SMILES | C=CCCl.N.O=C(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H10O2.C3H5Cl.H3N/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;1-2-3-4;/h1-10H;2H,1,3H2;1H3 |
| InChIKey | VASLPCWPCWLRFI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|