C19H22BrNO2 — CID 174526746
1,2-diphenylethane-1,2-dione;ethenyl(trimethyl)azanium;bromide (PubChem CID 174526746) has the molecular formula C19H22BrNO2 and a molecular weight of 376.29 g/mol. Its IUPAC name is 1,2-diphenylethane-1,2-dione;ethenyl(trimethyl)azanium;bromide.
| Compound Name | 1,2-diphenylethane-1,2-dione;ethenyl(trimethyl)azanium;bromide |
|---|---|
| PubChem CID | 174526746 |
| Molecular Formula | C19H22BrNO2 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 1,2-diphenylethane-1,2-dione;ethenyl(trimethyl)azanium;bromide |
| SMILES | C=C[N+](C)(C)C.O=C(C(=O)c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C14H10O2.C5H12N.BrH/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;1-5-6(2,3)4;/h1-10H;5H,1H2,2-4H3;1H/q;+1;/p-1 |
| InChIKey | JYSRVKRHJIBYBW-UHFFFAOYSA-M |
| XLogP | 0.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|