C13H15NO — CID 173287666
2-(dimethylamino)-1-phenylpenta-2,4-dien-1-one (PubChem CID 173287666) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-(dimethylamino)-1-phenylpenta-2,4-dien-1-one.
| Compound Name | 2-(dimethylamino)-1-phenylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 173287666 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 2-(dimethylamino)-1-phenylpenta-2,4-dien-1-one |
| SMILES | C=CC=C(C(=O)c1ccccc1)N(C)C |
| InChI | InChI=1S/C13H15NO/c1-4-8-12(14(2)3)13(15)11-9-6-5-7-10-11/h4-10H,1H2,2-3H3 |
| InChIKey | CMLPZMJQNOHAMV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|