About (2Z)-2-benzoylpenta-2,4-dienethial
(2Z)-2-benzoylpenta-2,4-dienethial (PubChem CID 146179532) has the molecular formula C12H10OS
and a molecular weight of 202.28 g/mol. Its IUPAC name is (2Z)-2-benzoylpenta-2,4-dienethial.
Molecular Properties
| Compound Name | (2Z)-2-benzoylpenta-2,4-dienethial |
| PubChem CID | 146179532 |
| Molecular Formula | C12H10OS |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | (2Z)-2-benzoylpenta-2,4-dienethial |
| SMILES | C=C/C=C(\C=S)C(=O)c1ccccc1 |
| InChI | InChI=1S/C12H10OS/c1-2-6-11(9-14)12(13)10-7-4-3-5-8-10/h2-9H,1H2/b11-6+ |
| InChIKey | FTQVOKFDVQOWIU-IZZDOVSWSA-N |
| XLogP | 2.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-benzoylpenta-2,4-dienethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-benzoylpenta-2,4-dienethial?
The IUPAC name of (2Z)-2-benzoylpenta-2,4-dienethial (CID 146179532) is (2Z)-2-benzoylpenta-2,4-dienethial.
What is the SMILES notation for (2Z)-2-benzoylpenta-2,4-dienethial?
The canonical SMILES for (2Z)-2-benzoylpenta-2,4-dienethial is C=C/C=C(\C=S)C(=O)c1ccccc1.
What is the InChIKey of (2Z)-2-benzoylpenta-2,4-dienethial?
The InChIKey is FTQVOKFDVQOWIU-IZZDOVSWSA-N. The full InChI is InChI=1S/C12H10OS/c1-2-6-11(9-14)12(13)10-7-4-3-5-8-10/h2-9H,1H2/b11-6+.
What are the key properties of (2Z)-2-benzoylpenta-2,4-dienethial?
(2Z)-2-benzoylpenta-2,4-dienethial has a molecular weight of 202.28 g/mol, XLogP of 2.98, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-benzoylpenta-2,4-dienethial is sourced from PubChem (CID 146179532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).