C12H12O2 — CID 102389363
methyl (2E)-2-phenylpenta-2,4-dienoate (PubChem CID 102389363) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is methyl (2E)-2-phenylpenta-2,4-dienoate.
| Compound Name | methyl (2E)-2-phenylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 102389363 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | methyl (2E)-2-phenylpenta-2,4-dienoate |
| SMILES | C=C/C=C(/C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C12H12O2/c1-3-7-11(12(13)14-2)10-8-5-4-6-9-10/h3-9H,1H2,2H3/b11-7+ |
| InChIKey | CUISUHHWCVWKIB-YRNVUSSQSA-N |
| XLogP | 2.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|