C20H18O3 — CID 166438675
methyl (2E,4E)-5-(4-acetylphenyl)-2-phenylpenta-2,4-dienoate (PubChem CID 166438675) has the molecular formula C20H18O3 and a molecular weight of 306.36 g/mol. Its IUPAC name is methyl (2E,4E)-5-(4-acetylphenyl)-2-phenylpenta-2,4-dienoate.
| Compound Name | methyl (2E,4E)-5-(4-acetylphenyl)-2-phenylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 166438675 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | methyl (2E,4E)-5-(4-acetylphenyl)-2-phenylpenta-2,4-dienoate |
| SMILES | COC(=O)/C(=C/C=C/c1ccc(C(C)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H18O3/c1-15(21)17-13-11-16(12-14-17)7-6-10-19(20(22)23-2)18-8-4-3-5-9-18/h3-14H,1-2H3/b7-6+,19-10+ |
| InChIKey | NTIAFJOMBZPTGR-UKRGCJTISA-N |
| XLogP | 4.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|