C15H15BrO3 — CID 139881325
methyl (2E,3E,5E)-3-bromo-2-(methoxymethylidene)-6-phenylhexa-3,5-dienoate (PubChem CID 139881325) has the molecular formula C15H15BrO3 and a molecular weight of 323.19 g/mol. Its IUPAC name is methyl (2E,3E,5E)-3-bromo-2-(methoxymethylidene)-6-phenylhexa-3,5-dienoate.
| Compound Name | methyl (2E,3E,5E)-3-bromo-2-(methoxymethylidene)-6-phenylhexa-3,5-dienoate |
|---|---|
| PubChem CID | 139881325 |
| Molecular Formula | C15H15BrO3 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | methyl (2E,3E,5E)-3-bromo-2-(methoxymethylidene)-6-phenylhexa-3,5-dienoate |
| SMILES | CO/C=C(C(=O)OC)/C(Br)=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C15H15BrO3/c1-18-11-13(15(17)19-2)14(16)10-6-9-12-7-4-3-5-8-12/h3-11H,1-2H3/b9-6+,13-11-,14-10+ |
| InChIKey | RYLYHJGFRLORBQ-PHJFVHRVSA-N |
| XLogP | 3.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|