C10H8BrF — CID 134853789
[(1E)-4-bromo-4-fluorobuta-1,3-dienyl]benzene (PubChem CID 134853789) has the molecular formula C10H8BrF and a molecular weight of 227.08 g/mol. Its IUPAC name is [(1E)-4-bromo-4-fluorobuta-1,3-dienyl]benzene.
| Compound Name | [(1E)-4-bromo-4-fluorobuta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 134853789 |
| Molecular Formula | C10H8BrF |
| Molecular Weight | 227.08 g/mol |
| Exact Mass | 225.98 |
| IUPAC Name | [(1E)-4-bromo-4-fluorobuta-1,3-dienyl]benzene |
| SMILES | FC(Br)=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C10H8BrF/c11-10(12)8-4-7-9-5-2-1-3-6-9/h1-8H/b7-4+,10-8? |
| InChIKey | FRAZEIWMKUTZGW-ZWZRPYISSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.08 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|