C18H14 — CID 100974511
[(1E,3Z)-4-phenylhexa-1,3-dien-5-ynyl]benzene (PubChem CID 100974511) has the molecular formula C18H14 and a molecular weight of 230.31 g/mol. Its IUPAC name is [(1E,3Z)-4-phenylhexa-1,3-dien-5-ynyl]benzene.
| Compound Name | [(1E,3Z)-4-phenylhexa-1,3-dien-5-ynyl]benzene |
|---|---|
| PubChem CID | 100974511 |
| Molecular Formula | C18H14 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | [(1E,3Z)-4-phenylhexa-1,3-dien-5-ynyl]benzene |
| SMILES | C#C/C(=C/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H14/c1-2-17(18-13-7-4-8-14-18)15-9-12-16-10-5-3-6-11-16/h1,3-15H/b12-9+,17-15- |
| InChIKey | CNPAUXVECSHAFS-PCEKLBEFSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|