C18H15NO — CID 3317052
2-(4-methoxyphenyl)-5-phenylpenta-2,4-dienenitrile (PubChem CID 3317052) has the molecular formula C18H15NO and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-5-phenylpenta-2,4-dienenitrile.
| Compound Name | 2-(4-methoxyphenyl)-5-phenylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 3317052 |
| Molecular Formula | C18H15NO |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2-(4-methoxyphenyl)-5-phenylpenta-2,4-dienenitrile |
| SMILES | COc1ccc(C(C#N)=CC=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H15NO/c1-20-18-12-10-16(11-13-18)17(14-19)9-5-8-15-6-3-2-4-7-15/h2-13H,1H3 |
| InChIKey | GQJQOXKMNJCVNQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|