C18H13F2NO2 — CID 155774784
(E)-4,4-difluoro-5-(4-methoxyphenyl)-5-oxo-2-phenylpent-2-enenitrile (PubChem CID 155774784) has the molecular formula C18H13F2NO2 and a molecular weight of 313.30 g/mol. Its IUPAC name is (E)-4,4-difluoro-5-(4-methoxyphenyl)-5-oxo-2-phenylpent-2-enenitrile.
| Compound Name | (E)-4,4-difluoro-5-(4-methoxyphenyl)-5-oxo-2-phenylpent-2-enenitrile |
|---|---|
| PubChem CID | 155774784 |
| Molecular Formula | C18H13F2NO2 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (E)-4,4-difluoro-5-(4-methoxyphenyl)-5-oxo-2-phenylpent-2-enenitrile |
| SMILES | COc1ccc(C(=O)C(F)(F)/C=C(/C#N)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H13F2NO2/c1-23-16-9-7-14(8-10-16)17(22)18(19,20)11-15(12-21)13-5-3-2-4-6-13/h2-11H,1H3/b15-11- |
| InChIKey | OLJMUVDCRVSHLF-PTNGSMBKSA-N |
| XLogP | 4.12 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|