C11H10ClF3O3 — CID 101453823
2-chloro-3,3,3-trifluoro-2-methoxy-1-(4-methoxyphenyl)propan-1-one (PubChem CID 101453823) has the molecular formula C11H10ClF3O3 and a molecular weight of 282.65 g/mol. Its IUPAC name is 2-chloro-3,3,3-trifluoro-2-methoxy-1-(4-methoxyphenyl)propan-1-one.
| Compound Name | 2-chloro-3,3,3-trifluoro-2-methoxy-1-(4-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 101453823 |
| Molecular Formula | C11H10ClF3O3 |
| Molecular Weight | 282.65 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 2-chloro-3,3,3-trifluoro-2-methoxy-1-(4-methoxyphenyl)propan-1-one |
| SMILES | COc1ccc(C(=O)C(Cl)(OC)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H10ClF3O3/c1-17-8-5-3-7(4-6-8)9(16)10(12,18-2)11(13,14)15/h3-6H,1-2H3 |
| InChIKey | JXOFIAZHWFFRSL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.65 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|