C13H9F3O2 — CID 24726833
2,2,2-trifluoro-1-(6-methoxynaphthalen-2-yl)ethanone (PubChem CID 24726833) has the molecular formula C13H9F3O2 and a molecular weight of 254.21 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(6-methoxynaphthalen-2-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(6-methoxynaphthalen-2-yl)ethanone |
|---|---|
| PubChem CID | 24726833 |
| Molecular Formula | C13H9F3O2 |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 2,2,2-trifluoro-1-(6-methoxynaphthalen-2-yl)ethanone |
| SMILES | COc1ccc2cc(C(=O)C(F)(F)F)ccc2c1 |
| InChI | InChI=1S/C13H9F3O2/c1-18-11-5-4-8-6-10(3-2-9(8)7-11)12(17)13(14,15)16/h2-7H,1H3 |
| InChIKey | DGUJNJQFAWNYEY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |