C18H20O3 — CID 21354869
(Z)-3-(6-methoxynaphthalen-2-yl)-2,2-dimethylpent-3-enoic acid (PubChem CID 21354869) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is (Z)-3-(6-methoxynaphthalen-2-yl)-2,2-dimethylpent-3-enoic acid.
| Compound Name | (Z)-3-(6-methoxynaphthalen-2-yl)-2,2-dimethylpent-3-enoic acid |
|---|---|
| PubChem CID | 21354869 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (Z)-3-(6-methoxynaphthalen-2-yl)-2,2-dimethylpent-3-enoic acid |
| SMILES | C/C=C(/c1ccc2cc(OC)ccc2c1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C18H20O3/c1-5-16(18(2,3)17(19)20)14-7-6-13-11-15(21-4)9-8-12(13)10-14/h5-11H,1-4H3,(H,19,20)/b16-5- |
| InChIKey | ARMLYYXIJXARED-BNCCVWRVSA-N |
| XLogP | 4.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |