C17H18O4 — CID 65298740
4-(6-methoxynaphthalen-2-yl)-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 65298740) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is 4-(6-methoxynaphthalen-2-yl)-2,2-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-(6-methoxynaphthalen-2-yl)-2,2-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 65298740 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 4-(6-methoxynaphthalen-2-yl)-2,2-dimethyl-4-oxobutanoic acid |
| SMILES | COc1ccc2cc(C(=O)CC(C)(C)C(=O)O)ccc2c1 |
| InChI | InChI=1S/C17H18O4/c1-17(2,16(19)20)10-15(18)13-5-4-12-9-14(21-3)7-6-11(12)8-13/h4-9H,10H2,1-3H3,(H,19,20) |
| InChIKey | VFLPBLISXXZKMC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |