C18H19NaO3 — CID 21354868
sodium (Z)-3-(6-methoxynaphthalen-2-yl)-2,2-dimethylpent-3-enoate (PubChem CID 21354868) has the molecular formula C18H19NaO3 and a molecular weight of 306.34 g/mol. Its IUPAC name is sodium (Z)-3-(6-methoxynaphthalen-2-yl)-2,2-dimethylpent-3-enoate.
| Compound Name | sodium (Z)-3-(6-methoxynaphthalen-2-yl)-2,2-dimethylpent-3-enoate |
|---|---|
| PubChem CID | 21354868 |
| Molecular Formula | C18H19NaO3 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | sodium (Z)-3-(6-methoxynaphthalen-2-yl)-2,2-dimethylpent-3-enoate |
| SMILES | C/C=C(/c1ccc2cc(OC)ccc2c1)C(C)(C)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C18H20O3.Na/c1-5-16(18(2,3)17(19)20)14-7-6-13-11-15(21-4)9-8-12(13)10-14;/h5-11H,1-4H3,(H,19,20);/q;+1/p-1/b16-5-; |
| InChIKey | XHGQPFAGUVUQDQ-ZTQBIIPRSA-M |
| XLogP | 0.03 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |