C10H9F3O3 — CID 2758493
1-(3,4-dimethoxyphenyl)-2,2,2-trifluoroethanone (PubChem CID 2758493) has the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 2758493 |
| Molecular Formula | C10H9F3O3 |
| Molecular Weight | 234.17 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2,2,2-trifluoroethanone |
| SMILES | COc1ccc(C(=O)C(F)(F)F)cc1OC |
| InChI | InChI=1S/C10H9F3O3/c1-15-7-4-3-6(5-8(7)16-2)9(14)10(11,12)13/h3-5H,1-2H3 |
| InChIKey | YFISYXOGMSGFRE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.17 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |