C13H15F3O2 — CID 91656292
1-(4-butoxy-3-methylphenyl)-2,2,2-trifluoroethanone (PubChem CID 91656292) has the molecular formula C13H15F3O2 and a molecular weight of 260.25 g/mol. Its IUPAC name is 1-(4-butoxy-3-methylphenyl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(4-butoxy-3-methylphenyl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 91656292 |
| Molecular Formula | C13H15F3O2 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-(4-butoxy-3-methylphenyl)-2,2,2-trifluoroethanone |
| SMILES | CCCCOc1ccc(C(=O)C(F)(F)F)cc1C |
| InChI | InChI=1S/C13H15F3O2/c1-3-4-7-18-11-6-5-10(8-9(11)2)12(17)13(14,15)16/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | PLBKQAZCVGWHMB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|