C12H14F3NO2 — CID 82152534
1-(3-amino-4-butoxyphenyl)-2,2,2-trifluoroethanone (PubChem CID 82152534) has the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. Its IUPAC name is 1-(3-amino-4-butoxyphenyl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(3-amino-4-butoxyphenyl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 82152534 |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 1-(3-amino-4-butoxyphenyl)-2,2,2-trifluoroethanone |
| SMILES | CCCCOc1ccc(C(=O)C(F)(F)F)cc1N |
| InChI | InChI=1S/C12H14F3NO2/c1-2-3-6-18-10-5-4-8(7-9(10)16)11(17)12(13,14)15/h4-5,7H,2-3,6,16H2,1H3 |
| InChIKey | ZONWIRPLSGAGEP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|