C45H45F9O6 — CID 102572345
2,2,2-trifluoro-1-[4-[[2,4,6-tributyl-3,5-bis[[4-(2,2,2-trifluoroacetyl)phenoxy]methyl]phenyl]methoxy]phenyl]ethanone (PubChem CID 102572345) has the molecular formula C45H45F9O6 and a molecular weight of 852.83 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-[[2,4,6-tributyl-3,5-bis[[4-(2,2,2-trifluoroacetyl)phenoxy]methyl]phenyl]methoxy]phenyl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[4-[[2,4,6-tributyl-3,5-bis[[4-(2,2,2-trifluoroacetyl)phenoxy]methyl]phenyl]methoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 102572345 |
| Molecular Formula | C45H45F9O6 |
| Molecular Weight | 852.83 g/mol |
| Exact Mass | 852.31 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-[[2,4,6-tributyl-3,5-bis[[4-(2,2,2-trifluoroacetyl)phenoxy]methyl]phenyl]methoxy]phenyl]ethanone |
| SMILES | CCCCc1c(COc2ccc(C(=O)C(F)(F)F)cc2)c(CCCC)c(COc2ccc(C(=O)C(F)(F)F)cc2)c(CCCC)c1COc1ccc(C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C45H45F9O6/c1-4-7-10-34-37(25-58-31-19-13-28(14-20-31)40(55)43(46,47)48)35(11-8-5-2)39(27-60-33-23-17-30(18-24-33)42(57)45(52,53)54)36(12-9-6-3)38(34)26-59-32-21-15-29(16-22-32)41(56)44(49,50)51/h13-24H,4-12,25-27H2,1-3H3 |
| InChIKey | CPDKFLFQSMHLRR-UHFFFAOYSA-N |
| XLogP | 12.69 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.83 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |