C11H11F3O2 — CID 62961699
2,2,2-trifluoro-1-(4-propan-2-yloxyphenyl)ethanone (PubChem CID 62961699) has the molecular formula C11H11F3O2 and a molecular weight of 232.20 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(4-propan-2-yloxyphenyl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(4-propan-2-yloxyphenyl)ethanone |
|---|---|
| PubChem CID | 62961699 |
| Molecular Formula | C11H11F3O2 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 2,2,2-trifluoro-1-(4-propan-2-yloxyphenyl)ethanone |
| SMILES | CC(C)Oc1ccc(C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H11F3O2/c1-7(2)16-9-5-3-8(4-6-9)10(15)11(12,13)14/h3-7H,1-2H3 |
| InChIKey | CNFUQXVFTQLUFK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |