C12H11F5O2 — CID 114037996
2,2,3,3,3-pentafluoro-1-(4-propan-2-yloxyphenyl)propan-1-one (PubChem CID 114037996) has the molecular formula C12H11F5O2 and a molecular weight of 282.21 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(4-propan-2-yloxyphenyl)propan-1-one.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(4-propan-2-yloxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 114037996 |
| Molecular Formula | C12H11F5O2 |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(4-propan-2-yloxyphenyl)propan-1-one |
| SMILES | CC(C)Oc1ccc(C(=O)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H11F5O2/c1-7(2)19-9-5-3-8(4-6-9)10(18)11(13,14)12(15,16)17/h3-7H,1-2H3 |
| InChIKey | IOCQSSNVWGKONM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|