C15H23NO2 — CID 116557003
2-amino-2-methyl-1-(4-propan-2-yloxyphenyl)pentan-1-one (PubChem CID 116557003) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-amino-2-methyl-1-(4-propan-2-yloxyphenyl)pentan-1-one.
| Compound Name | 2-amino-2-methyl-1-(4-propan-2-yloxyphenyl)pentan-1-one |
|---|---|
| PubChem CID | 116557003 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-amino-2-methyl-1-(4-propan-2-yloxyphenyl)pentan-1-one |
| SMILES | CCCC(C)(N)C(=O)c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C15H23NO2/c1-5-10-15(4,16)14(17)12-6-8-13(9-7-12)18-11(2)3/h6-9,11H,5,10,16H2,1-4H3 |
| InChIKey | BQJGFOKCSRVMKH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |