C17H29ClN2O3 — CID 119792716
2-amino-N-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-2-methylpentanamide;hydrochloride (PubChem CID 119792716) has the molecular formula C17H29ClN2O3 and a molecular weight of 344.88 g/mol. Its IUPAC name is 2-amino-N-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-2-methylpentanamide;hydrochloride.
| Compound Name | 2-amino-N-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-2-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119792716 |
| Molecular Formula | C17H29ClN2O3 |
| Molecular Weight | 344.88 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 2-amino-N-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-2-methylpentanamide;hydrochloride |
| SMILES | CCCC(C)(N)C(=O)NCC(O)c1ccc(OC(C)C)cc1.Cl |
| InChI | InChI=1S/C17H28N2O3.ClH/c1-5-10-17(4,18)16(21)19-11-15(20)13-6-8-14(9-7-13)22-12(2)3;/h6-9,12,15,20H,5,10-11,18H2,1-4H3,(H,19,21);1H |
| InChIKey | NOCJKRJDRLEKNN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.88 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |