C13H13F5O2 — CID 146005397
2,2,3,3,3-pentafluoro-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-1-one (PubChem CID 146005397) has the molecular formula C13H13F5O2 and a molecular weight of 296.24 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-1-one.
| Compound Name | 2,2,3,3,3-pentafluoro-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-1-one |
|---|---|
| PubChem CID | 146005397 |
| Molecular Formula | C13H13F5O2 |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-1-one |
| SMILES | CC(C)(C)Oc1ccc(C(=O)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H13F5O2/c1-11(2,3)20-9-6-4-8(5-7-9)10(19)12(14,15)13(16,17)18/h4-7H,1-3H3 |
| InChIKey | NPRXAZFRODQAAP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|