C21H22F4O2 — CID 144950312
(4-tert-butyl-2,3,5,6-tetrafluorophenyl)-[4-[(2-methylpropan-2-yl)oxy]phenyl]methanone (PubChem CID 144950312) has the molecular formula C21H22F4O2 and a molecular weight of 382.40 g/mol. Its IUPAC name is (4-tert-butyl-2,3,5,6-tetrafluorophenyl)-[4-[(2-methylpropan-2-yl)oxy]phenyl]methanone.
| Compound Name | (4-tert-butyl-2,3,5,6-tetrafluorophenyl)-[4-[(2-methylpropan-2-yl)oxy]phenyl]methanone |
|---|---|
| PubChem CID | 144950312 |
| Molecular Formula | C21H22F4O2 |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | (4-tert-butyl-2,3,5,6-tetrafluorophenyl)-[4-[(2-methylpropan-2-yl)oxy]phenyl]methanone |
| SMILES | CC(C)(C)Oc1ccc(C(=O)c2c(F)c(F)c(C(C)(C)C)c(F)c2F)cc1 |
| InChI | InChI=1S/C21H22F4O2/c1-20(2,3)14-17(24)15(22)13(16(23)18(14)25)19(26)11-7-9-12(10-8-11)27-21(4,5)6/h7-10H,1-6H3 |
| InChIKey | PJPCTDHDHOPREI-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|