C9H4ClF5O2 — CID 19915312
2-chloro-2,2-difluoro-1-[4-(trifluoromethoxy)phenyl]ethanone (PubChem CID 19915312) has the molecular formula C9H4ClF5O2 and a molecular weight of 274.57 g/mol. Its IUPAC name is 2-chloro-2,2-difluoro-1-[4-(trifluoromethoxy)phenyl]ethanone.
| Compound Name | 2-chloro-2,2-difluoro-1-[4-(trifluoromethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 19915312 |
| Molecular Formula | C9H4ClF5O2 |
| Molecular Weight | 274.57 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 2-chloro-2,2-difluoro-1-[4-(trifluoromethoxy)phenyl]ethanone |
| SMILES | O=C(c1ccc(OC(F)(F)F)cc1)C(F)(F)Cl |
| InChI | InChI=1S/C9H4ClF5O2/c10-8(11,12)7(16)5-1-3-6(4-2-5)17-9(13,14)15/h1-4H |
| InChIKey | GTXBNGSCGAEEPL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|