C20H16F6O4 — CID 10502949
1,6-bis[4-(trifluoromethoxy)phenyl]hexane-1,6-dione (PubChem CID 10502949) has the molecular formula C20H16F6O4 and a molecular weight of 434.33 g/mol. Its IUPAC name is 1,6-bis[4-(trifluoromethoxy)phenyl]hexane-1,6-dione.
| Compound Name | 1,6-bis[4-(trifluoromethoxy)phenyl]hexane-1,6-dione |
|---|---|
| PubChem CID | 10502949 |
| Molecular Formula | C20H16F6O4 |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 1,6-bis[4-(trifluoromethoxy)phenyl]hexane-1,6-dione |
| SMILES | O=C(CCCCC(=O)c1ccc(OC(F)(F)F)cc1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H16F6O4/c21-19(22,23)29-15-9-5-13(6-10-15)17(27)3-1-2-4-18(28)14-7-11-16(12-8-14)30-20(24,25)26/h5-12H,1-4H2 |
| InChIKey | WNNKHMUFTLVEAG-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|