C17H21F2O4- — CID 168826236
2,2-difluoro-2-(4-nonanoylphenoxy)acetate (PubChem CID 168826236) has the molecular formula C17H21F2O4- and a molecular weight of 327.35 g/mol. Its IUPAC name is 2,2-difluoro-2-(4-nonanoylphenoxy)acetate.
| Compound Name | 2,2-difluoro-2-(4-nonanoylphenoxy)acetate |
|---|---|
| PubChem CID | 168826236 |
| Molecular Formula | C17H21F2O4- |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2,2-difluoro-2-(4-nonanoylphenoxy)acetate |
| SMILES | CCCCCCCCC(=O)c1ccc(OC(F)(F)C(=O)[O-])cc1 |
| InChI | InChI=1S/C17H22F2O4/c1-2-3-4-5-6-7-8-15(20)13-9-11-14(12-10-13)23-17(18,19)16(21)22/h9-12H,2-8H2,1H3,(H,21,22)/p-1 |
| InChIKey | ADSNDVWZLGGEHP-UHFFFAOYSA-M |
| XLogP | 3.34 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|