About (4-undecanoylphenyl) dihydrogen phosphite
(4-undecanoylphenyl) dihydrogen phosphite (PubChem CID 174776002) has the molecular formula C17H27O4P
and a molecular weight of 326.37 g/mol. Its IUPAC name is (4-undecanoylphenyl) dihydrogen phosphite.
Molecular Properties
| Compound Name | (4-undecanoylphenyl) dihydrogen phosphite |
| PubChem CID | 174776002 |
| Molecular Formula | C17H27O4P |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (4-undecanoylphenyl) dihydrogen phosphite |
| SMILES | CCCCCCCCCCC(=O)c1ccc(OP(O)O)cc1 |
| InChI | InChI=1S/C17H27O4P/c1-2-3-4-5-6-7-8-9-10-17(18)15-11-13-16(14-12-15)21-22(19)20/h11-14,19-20H,2-10H2,1H3 |
| InChIKey | AFVKUMGLLMHKCY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-undecanoylphenyl) dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-undecanoylphenyl) dihydrogen phosphite?
The IUPAC name of (4-undecanoylphenyl) dihydrogen phosphite (CID 174776002) is (4-undecanoylphenyl) dihydrogen phosphite.
What is the SMILES notation for (4-undecanoylphenyl) dihydrogen phosphite?
The canonical SMILES for (4-undecanoylphenyl) dihydrogen phosphite is CCCCCCCCCCC(=O)c1ccc(OP(O)O)cc1.
What is the InChIKey of (4-undecanoylphenyl) dihydrogen phosphite?
The InChIKey is AFVKUMGLLMHKCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27O4P/c1-2-3-4-5-6-7-8-9-10-17(18)15-11-13-16(14-12-15)21-22(19)20/h11-14,19-20H,2-10H2,1H3.
What are the key properties of (4-undecanoylphenyl) dihydrogen phosphite?
(4-undecanoylphenyl) dihydrogen phosphite has a molecular weight of 326.37 g/mol, XLogP of 4.99, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-undecanoylphenyl) dihydrogen phosphite is sourced from PubChem (CID 174776002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).