About (4-nonanoylphenyl) dihydrogen phosphate
(4-nonanoylphenyl) dihydrogen phosphate (PubChem CID 171472641) has the molecular formula C15H23O5P
and a molecular weight of 314.32 g/mol. Its IUPAC name is (4-nonanoylphenyl) dihydrogen phosphate.
Molecular Properties
| Compound Name | (4-nonanoylphenyl) dihydrogen phosphate |
| PubChem CID | 171472641 |
| Molecular Formula | C15H23O5P |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (4-nonanoylphenyl) dihydrogen phosphate |
| SMILES | CCCCCCCCC(=O)c1ccc(OP(=O)(O)O)cc1 |
| InChI | InChI=1S/C15H23O5P/c1-2-3-4-5-6-7-8-15(16)13-9-11-14(12-10-13)20-21(17,18)19/h9-12H,2-8H2,1H3,(H2,17,18,19) |
| InChIKey | DMBHSYBINLNGSO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-nonanoylphenyl) dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nonanoylphenyl) dihydrogen phosphate?
The IUPAC name of (4-nonanoylphenyl) dihydrogen phosphate (CID 171472641) is (4-nonanoylphenyl) dihydrogen phosphate.
What is the SMILES notation for (4-nonanoylphenyl) dihydrogen phosphate?
The canonical SMILES for (4-nonanoylphenyl) dihydrogen phosphate is CCCCCCCCC(=O)c1ccc(OP(=O)(O)O)cc1.
What is the InChIKey of (4-nonanoylphenyl) dihydrogen phosphate?
The InChIKey is DMBHSYBINLNGSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23O5P/c1-2-3-4-5-6-7-8-15(16)13-9-11-14(12-10-13)20-21(17,18)19/h9-12H,2-8H2,1H3,(H2,17,18,19).
What are the key properties of (4-nonanoylphenyl) dihydrogen phosphate?
(4-nonanoylphenyl) dihydrogen phosphate has a molecular weight of 314.32 g/mol, XLogP of 4.09, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nonanoylphenyl) dihydrogen phosphate is sourced from PubChem (CID 171472641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).