About CID 175394563
CID 175394563 (PubChem CID 175394563) has the molecular formula C16H11BF5O3
and a molecular weight of 357.06 g/mol.
Molecular Properties
| Compound Name | CID 175394563 |
| PubChem CID | 175394563 |
| Molecular Formula | C16H11BF5O3 |
| Molecular Weight | 357.06 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | — |
| SMILES | F[B]F.O=C(CC(=O)c1ccc(OC(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C16H11F3O3.BF2/c17-16(18,19)22-13-8-6-12(7-9-13)15(21)10-14(20)11-4-2-1-3-5-11;2-1-3/h1-9H,10H2; |
| InChIKey | LPRYJVXVYVJYHM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.06 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175394563 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175394563?
The IUPAC name of CID 175394563 (CID 175394563) is not available.
What is the SMILES notation for CID 175394563?
The canonical SMILES for CID 175394563 is F[B]F.O=C(CC(=O)c1ccc(OC(F)(F)F)cc1)c1ccccc1.
What is the InChIKey of CID 175394563?
The InChIKey is LPRYJVXVYVJYHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11F3O3.BF2/c17-16(18,19)22-13-8-6-12(7-9-13)15(21)10-14(20)11-4-2-1-3-5-11;2-1-3/h1-9H,10H2;.
What are the key properties of CID 175394563?
CID 175394563 has a molecular weight of 357.06 g/mol, XLogP of 4.50, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175394563 is sourced from PubChem (CID 175394563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).