C12H13ClF2O2 — CID 171367486
2-chloro-2,2-difluoro-1-[4-(2-methylpropoxy)phenyl]ethanone (PubChem CID 171367486) has the molecular formula C12H13ClF2O2 and a molecular weight of 262.68 g/mol. Its IUPAC name is 2-chloro-2,2-difluoro-1-[4-(2-methylpropoxy)phenyl]ethanone.
| Compound Name | 2-chloro-2,2-difluoro-1-[4-(2-methylpropoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 171367486 |
| Molecular Formula | C12H13ClF2O2 |
| Molecular Weight | 262.68 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2-chloro-2,2-difluoro-1-[4-(2-methylpropoxy)phenyl]ethanone |
| SMILES | CC(C)COc1ccc(C(=O)C(F)(F)Cl)cc1 |
| InChI | InChI=1S/C12H13ClF2O2/c1-8(2)7-17-10-5-3-9(4-6-10)11(16)12(13,14)15/h3-6,8H,7H2,1-2H3 |
| InChIKey | RDVIBZSDNYIIMI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.68 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|