C12H5F11O2 — CID 146008869
2,2,3,3,4,4,4-heptafluoro-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-one (PubChem CID 146008869) has the molecular formula C12H5F11O2 and a molecular weight of 390.15 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-one.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-one |
|---|---|
| PubChem CID | 146008869 |
| Molecular Formula | C12H5F11O2 |
| Molecular Weight | 390.15 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-one |
| SMILES | O=C(c1ccc(OC(F)(F)C(F)F)cc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H5F11O2/c13-8(14)10(17,18)25-6-3-1-5(2-4-6)7(24)9(15,16)11(19,20)12(21,22)23/h1-4,8H |
| InChIKey | OJQWQXTWKSWPEH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.15 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|