C17H11ClF4O2 — CID 88645389
(E)-1-(4-chlorophenyl)-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]prop-2-en-1-one (PubChem CID 88645389) has the molecular formula C17H11ClF4O2 and a molecular weight of 358.72 g/mol. Its IUPAC name is (E)-1-(4-chlorophenyl)-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-chlorophenyl)-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 88645389 |
| Molecular Formula | C17H11ClF4O2 |
| Molecular Weight | 358.72 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | (E)-1-(4-chlorophenyl)-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(OC(F)(F)C(F)F)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H11ClF4O2/c18-13-6-4-12(5-7-13)15(23)10-3-11-1-8-14(9-2-11)24-17(21,22)16(19)20/h1-10,16H/b10-3+ |
| InChIKey | CLXUSCQJXRBDAL-XCVCLJGOSA-N |
| XLogP | 5.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.72 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|