C10H7ClF4O3S — CID 91170423
2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethenesulfonyl chloride (PubChem CID 91170423) has the molecular formula C10H7ClF4O3S and a molecular weight of 318.68 g/mol. Its IUPAC name is 2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethenesulfonyl chloride.
| Compound Name | 2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethenesulfonyl chloride |
|---|---|
| PubChem CID | 91170423 |
| Molecular Formula | C10H7ClF4O3S |
| Molecular Weight | 318.68 g/mol |
| Exact Mass | 317.97 |
| IUPAC Name | 2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)C=Cc1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C10H7ClF4O3S/c11-19(16,17)6-5-7-1-3-8(4-2-7)18-10(14,15)9(12)13/h1-6,9H |
| InChIKey | IRSBUKBNNCZUIS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.68 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|