C24H16F6O2 — CID 23625072
1,4-bis[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]benzene (PubChem CID 23625072) has the molecular formula C24H16F6O2 and a molecular weight of 450.38 g/mol. Its IUPAC name is 1,4-bis[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]benzene.
| Compound Name | 1,4-bis[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 23625072 |
| Molecular Formula | C24H16F6O2 |
| Molecular Weight | 450.38 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 1,4-bis[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]benzene |
| SMILES | FC(F)(F)Oc1ccc(/C=C/c2ccc(/C=C/c3ccc(OC(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H16F6O2/c25-23(26,27)31-21-13-9-19(10-14-21)7-5-17-1-2-18(4-3-17)6-8-20-11-15-22(16-12-20)32-24(28,29)30/h1-16H/b7-5+,8-6+ |
| InChIKey | TUQFWXWEQKVVOY-KQQUZDAGSA-N |
| XLogP | 7.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.38 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|